C24H21ClN2OS — CID 11486972
[4-(4-methylphenyl)-3-oxo-5-phenyl-1,4-thiazepin-7-ylidene]-phenylazanium chloride (PubChem CID 11486972) has the molecular formula C24H21ClN2OS and a molecular weight of 420.97 g/mol. Its IUPAC name is [4-(4-methylphenyl)-3-oxo-5-phenyl-1,4-thiazepin-7-ylidene]-phenylazanium chloride.
| Compound Name | [4-(4-methylphenyl)-3-oxo-5-phenyl-1,4-thiazepin-7-ylidene]-phenylazanium chloride |
|---|---|
| PubChem CID | 11486972 |
| Molecular Formula | C24H21ClN2OS |
| Molecular Weight | 420.97 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | [4-(4-methylphenyl)-3-oxo-5-phenyl-1,4-thiazepin-7-ylidene]-phenylazanium chloride |
| SMILES | Cc1ccc(N2C(=O)CS/C(=[NH+]\c3ccccc3)C=C2c2ccccc2)cc1.[Cl-] |
| InChI | InChI=1S/C24H20N2OS.ClH/c1-18-12-14-21(15-13-18)26-22(19-8-4-2-5-9-19)16-23(28-17-24(26)27)25-20-10-6-3-7-11-20;/h2-16H,17H2,1H3;1H/b25-23-; |
| InChIKey | MNNGBZHAMCLQKH-ADYMNVQMSA-N |
| XLogP | 0.93 |
| TPSA | 34.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.97 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|