C21H19N3OS — CID 6443102
(2Z)-3-(4-methylphenyl)-2-[(naphthalen-2-ylamino)methylimino]-1,3-thiazolidin-4-one (PubChem CID 6443102) has the molecular formula C21H19N3OS and a molecular weight of 361.47 g/mol. Its IUPAC name is (2Z)-3-(4-methylphenyl)-2-[(naphthalen-2-ylamino)methylimino]-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-3-(4-methylphenyl)-2-[(naphthalen-2-ylamino)methylimino]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6443102 |
| Molecular Formula | C21H19N3OS |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | (2Z)-3-(4-methylphenyl)-2-[(naphthalen-2-ylamino)methylimino]-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(N2C(=O)CS/C2=N\CNc2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C21H19N3OS/c1-15-6-10-19(11-7-15)24-20(25)13-26-21(24)23-14-22-18-9-8-16-4-2-3-5-17(16)12-18/h2-12,22H,13-14H2,1H3/b23-21- |
| InChIKey | AWVFKWMWVLAWAG-LNVKXUELSA-N |
| XLogP | 4.65 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|