C18H15FN2O3S — CID 130385836
methyl 4-[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-3-yl]-3-methylbenzoate (PubChem CID 130385836) has the molecular formula C18H15FN2O3S and a molecular weight of 358.39 g/mol. Its IUPAC name is methyl 4-[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-3-yl]-3-methylbenzoate.
| Compound Name | methyl 4-[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-3-yl]-3-methylbenzoate |
|---|---|
| PubChem CID | 130385836 |
| Molecular Formula | C18H15FN2O3S |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | methyl 4-[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-3-yl]-3-methylbenzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)CS/C2=N\c2ccc(F)cc2)c(C)c1 |
| InChI | InChI=1S/C18H15FN2O3S/c1-11-9-12(17(23)24-2)3-8-15(11)21-16(22)10-25-18(21)20-14-6-4-13(19)5-7-14/h3-9H,10H2,1-2H3/b20-18- |
| InChIKey | GPVGNRQAYMVVGY-ZZEZOPTASA-N |
| XLogP | 3.69 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|