C23H35N3O5+2 — CID 9324238
(3aS,7aS)-2-[[4-[(2,3,4-trimethoxyphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 9324238) has the molecular formula C23H35N3O5+2 and a molecular weight of 433.55 g/mol. Its IUPAC name is (3aS,7aS)-2-[[4-[(2,3,4-trimethoxyphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aS,7aS)-2-[[4-[(2,3,4-trimethoxyphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 9324238 |
| Molecular Formula | C23H35N3O5+2 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | (3aS,7aS)-2-[[4-[(2,3,4-trimethoxyphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | COc1ccc(C[NH+]2CC[NH+](CN3C(=O)[C@H]4CCCC[C@@H]4C3=O)CC2)c(OC)c1OC |
| InChI | InChI=1S/C23H33N3O5/c1-29-19-9-8-16(20(30-2)21(19)31-3)14-24-10-12-25(13-11-24)15-26-22(27)17-6-4-5-7-18(17)23(26)28/h8-9,17-18H,4-7,10-15H2,1-3H3/p+2/t17-,18-/m0/s1 |
| InChIKey | QNFATPDLJJSBJI-ROUUACIJSA-P |
| XLogP | -0.87 |
| TPSA | 73.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|