C19H30N4O3S+2 — CID 9324213
1-methyl-3-[[4-[(2,3,4-trimethoxyphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]imidazole-2-thione (PubChem CID 9324213) has the molecular formula C19H30N4O3S+2 and a molecular weight of 394.54 g/mol. Its IUPAC name is 1-methyl-3-[[4-[(2,3,4-trimethoxyphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]imidazole-2-thione.
| Compound Name | 1-methyl-3-[[4-[(2,3,4-trimethoxyphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]imidazole-2-thione |
|---|---|
| PubChem CID | 9324213 |
| Molecular Formula | C19H30N4O3S+2 |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 1-methyl-3-[[4-[(2,3,4-trimethoxyphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]imidazole-2-thione |
| SMILES | COc1ccc(C[NH+]2CC[NH+](Cn3ccn(C)c3=S)CC2)c(OC)c1OC |
| InChI | InChI=1S/C19H28N4O3S/c1-20-7-12-23(19(20)27)14-22-10-8-21(9-11-22)13-15-5-6-16(24-2)18(26-4)17(15)25-3/h5-7,12H,8-11,13-14H2,1-4H3/p+2 |
| InChIKey | AQFRPYAXVJPEEA-UHFFFAOYSA-P |
| XLogP | -0.48 |
| TPSA | 46.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|