C33H33N3O4 — CID 43820938
2-(1,3-benzodioxol-5-yl)-N-[4-(dimethylamino)phenyl]-2-[(2-methylphenyl)methyl-(2-phenylacetyl)amino]acetamide (PubChem CID 43820938) has the molecular formula C33H33N3O4 and a molecular weight of 535.64 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[4-(dimethylamino)phenyl]-2-[(2-methylphenyl)methyl-(2-phenylacetyl)amino]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[4-(dimethylamino)phenyl]-2-[(2-methylphenyl)methyl-(2-phenylacetyl)amino]acetamide |
|---|---|
| PubChem CID | 43820938 |
| Molecular Formula | C33H33N3O4 |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[4-(dimethylamino)phenyl]-2-[(2-methylphenyl)methyl-(2-phenylacetyl)amino]acetamide |
| SMILES | Cc1ccccc1CN(C(=O)Cc1ccccc1)C(C(=O)Nc1ccc(N(C)C)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C33H33N3O4/c1-23-9-7-8-12-26(23)21-36(31(37)19-24-10-5-4-6-11-24)32(25-13-18-29-30(20-25)40-22-39-29)33(38)34-27-14-16-28(17-15-27)35(2)3/h4-18,20,32H,19,21-22H2,1-3H3,(H,34,38) |
| InChIKey | PZKLWGJONGBMEO-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|