C32H32FN3O3 — CID 2716521
(2S)-N-[4-(dimethylamino)phenyl]-2-[(4-fluorophenyl)methyl-(2-phenylacetyl)amino]-2-(4-methoxyphenyl)acetamide (PubChem CID 2716521) has the molecular formula C32H32FN3O3 and a molecular weight of 525.62 g/mol. Its IUPAC name is (2S)-N-[4-(dimethylamino)phenyl]-2-[(4-fluorophenyl)methyl-(2-phenylacetyl)amino]-2-(4-methoxyphenyl)acetamide.
| Compound Name | (2S)-N-[4-(dimethylamino)phenyl]-2-[(4-fluorophenyl)methyl-(2-phenylacetyl)amino]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 2716521 |
| Molecular Formula | C32H32FN3O3 |
| Molecular Weight | 525.62 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | (2S)-N-[4-(dimethylamino)phenyl]-2-[(4-fluorophenyl)methyl-(2-phenylacetyl)amino]-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc([C@@H](C(=O)Nc2ccc(N(C)C)cc2)N(Cc2ccc(F)cc2)C(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C32H32FN3O3/c1-35(2)28-17-15-27(16-18-28)34-32(38)31(25-11-19-29(39-3)20-12-25)36(22-24-9-13-26(33)14-10-24)30(37)21-23-7-5-4-6-8-23/h4-20,31H,21-22H2,1-3H3,(H,34,38)/t31-/m0/s1 |
| InChIKey | KVGKRUGAFLLENM-HKBQPEDESA-N |
| XLogP | 5.85 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.62 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|