C35H36FN3O5 — CID 43821479
2-(3,4-dimethoxyphenyl)-2-[(4-fluorophenyl)methyl-(2-phenylacetyl)amino]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 43821479) has the molecular formula C35H36FN3O5 and a molecular weight of 597.69 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-2-[(4-fluorophenyl)methyl-(2-phenylacetyl)amino]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-2-[(4-fluorophenyl)methyl-(2-phenylacetyl)amino]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 43821479 |
| Molecular Formula | C35H36FN3O5 |
| Molecular Weight | 597.69 g/mol |
| Exact Mass | 597.26 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-2-[(4-fluorophenyl)methyl-(2-phenylacetyl)amino]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | COc1ccc(C(C(=O)Nc2ccc(N3CCOCC3)cc2)N(Cc2ccc(F)cc2)C(=O)Cc2ccccc2)cc1OC |
| InChI | InChI=1S/C35H36FN3O5/c1-42-31-17-10-27(23-32(31)43-2)34(35(41)37-29-13-15-30(16-14-29)38-18-20-44-21-19-38)39(24-26-8-11-28(36)12-9-26)33(40)22-25-6-4-3-5-7-25/h3-17,23,34H,18-22,24H2,1-2H3,(H,37,41) |
| InChIKey | CBPHRNIDIAHZOC-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.69 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|