C33H35N3O3 — CID 43820935
N-[4-(dimethylamino)phenyl]-2-(3-methoxyphenyl)-2-[(2-methylphenyl)methyl-(2-phenylacetyl)amino]acetamide (PubChem CID 43820935) has the molecular formula C33H35N3O3 and a molecular weight of 521.66 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-2-(3-methoxyphenyl)-2-[(2-methylphenyl)methyl-(2-phenylacetyl)amino]acetamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-2-(3-methoxyphenyl)-2-[(2-methylphenyl)methyl-(2-phenylacetyl)amino]acetamide |
|---|---|
| PubChem CID | 43820935 |
| Molecular Formula | C33H35N3O3 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.27 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-2-(3-methoxyphenyl)-2-[(2-methylphenyl)methyl-(2-phenylacetyl)amino]acetamide |
| SMILES | COc1cccc(C(C(=O)Nc2ccc(N(C)C)cc2)N(Cc2ccccc2C)C(=O)Cc2ccccc2)c1 |
| InChI | InChI=1S/C33H35N3O3/c1-24-11-8-9-14-27(24)23-36(31(37)21-25-12-6-5-7-13-25)32(26-15-10-16-30(22-26)39-4)33(38)34-28-17-19-29(20-18-28)35(2)3/h5-20,22,32H,21,23H2,1-4H3,(H,34,38) |
| InChIKey | GWIUUMUDNWRKAB-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|