C18H18ClNO4 — CID 42651183
6-[(2-chlorophenyl)-morpholin-4-ylmethyl]-1,3-benzodioxol-5-ol (PubChem CID 42651183) has the molecular formula C18H18ClNO4 and a molecular weight of 347.80 g/mol. Its IUPAC name is 6-[(2-chlorophenyl)-morpholin-4-ylmethyl]-1,3-benzodioxol-5-ol.
| Compound Name | 6-[(2-chlorophenyl)-morpholin-4-ylmethyl]-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 42651183 |
| Molecular Formula | C18H18ClNO4 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 6-[(2-chlorophenyl)-morpholin-4-ylmethyl]-1,3-benzodioxol-5-ol |
| SMILES | Oc1cc2c(cc1C(c1ccccc1Cl)N1CCOCC1)OCO2 |
| InChI | InChI=1S/C18H18ClNO4/c19-14-4-2-1-3-12(14)18(20-5-7-22-8-6-20)13-9-16-17(10-15(13)21)24-11-23-16/h1-4,9-10,18,21H,5-8,11H2 |
| InChIKey | XWAOYCUGAZVUTI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|