C18H17F2NO4 — CID 2795633
6-[(3,5-difluorophenyl)-morpholin-4-ylmethyl]-1,3-benzodioxol-5-ol (PubChem CID 2795633) has the molecular formula C18H17F2NO4 and a molecular weight of 349.33 g/mol. Its IUPAC name is 6-[(3,5-difluorophenyl)-morpholin-4-ylmethyl]-1,3-benzodioxol-5-ol.
| Compound Name | 6-[(3,5-difluorophenyl)-morpholin-4-ylmethyl]-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 2795633 |
| Molecular Formula | C18H17F2NO4 |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 6-[(3,5-difluorophenyl)-morpholin-4-ylmethyl]-1,3-benzodioxol-5-ol |
| SMILES | Oc1cc2c(cc1C(c1cc(F)cc(F)c1)N1CCOCC1)OCO2 |
| InChI | InChI=1S/C18H17F2NO4/c19-12-5-11(6-13(20)7-12)18(21-1-3-23-4-2-21)14-8-16-17(9-15(14)22)25-10-24-16/h5-9,18,22H,1-4,10H2 |
| InChIKey | OOAHSJSAORNKHG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|