C22H29NO7 — CID 7033134
4,5-dimethoxy-2-[(S)-morpholin-4-yl-(3,4,5-trimethoxyphenyl)methyl]phenol (PubChem CID 7033134) has the molecular formula C22H29NO7 and a molecular weight of 419.47 g/mol. Its IUPAC name is 4,5-dimethoxy-2-[(S)-morpholin-4-yl-(3,4,5-trimethoxyphenyl)methyl]phenol.
| Compound Name | 4,5-dimethoxy-2-[(S)-morpholin-4-yl-(3,4,5-trimethoxyphenyl)methyl]phenol |
|---|---|
| PubChem CID | 7033134 |
| Molecular Formula | C22H29NO7 |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 4,5-dimethoxy-2-[(S)-morpholin-4-yl-(3,4,5-trimethoxyphenyl)methyl]phenol |
| SMILES | COc1cc(O)c([C@H](c2cc(OC)c(OC)c(OC)c2)N2CCOCC2)cc1OC |
| InChI | InChI=1S/C22H29NO7/c1-25-17-12-15(16(24)13-18(17)26-2)21(23-6-8-30-9-7-23)14-10-19(27-3)22(29-5)20(11-14)28-4/h10-13,21,24H,6-9H2,1-5H3/t21-/m0/s1 |
| InChIKey | GLKYHKSMUCCBFT-NRFANRHFSA-N |
| XLogP | 2.86 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|