C27H27NO6 — CID 42650679
8-[(3,4-dimethoxyphenyl)-morpholin-4-ylmethyl]-7-hydroxy-4-methylbenzo[h]chromen-2-one (PubChem CID 42650679) has the molecular formula C27H27NO6 and a molecular weight of 461.51 g/mol. Its IUPAC name is 8-[(3,4-dimethoxyphenyl)-morpholin-4-ylmethyl]-7-hydroxy-4-methylbenzo[h]chromen-2-one.
| Compound Name | 8-[(3,4-dimethoxyphenyl)-morpholin-4-ylmethyl]-7-hydroxy-4-methylbenzo[h]chromen-2-one |
|---|---|
| PubChem CID | 42650679 |
| Molecular Formula | C27H27NO6 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 8-[(3,4-dimethoxyphenyl)-morpholin-4-ylmethyl]-7-hydroxy-4-methylbenzo[h]chromen-2-one |
| SMILES | COc1ccc(C(c2ccc3c(ccc4c(C)cc(=O)oc43)c2O)N2CCOCC2)cc1OC |
| InChI | InChI=1S/C27H27NO6/c1-16-14-24(29)34-27-18(16)5-6-19-20(27)7-8-21(26(19)30)25(28-10-12-33-13-11-28)17-4-9-22(31-2)23(15-17)32-3/h4-9,14-15,25,30H,10-13H2,1-3H3 |
| InChIKey | VVYUIFPJDMHHCR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 81.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|