C26H32N2O5 — CID 29105469
5-methoxy-2-[(S)-(4-methylpiperazin-1-yl)-(3,4,5-trimethoxyphenyl)methyl]naphthalen-1-ol (PubChem CID 29105469) has the molecular formula C26H32N2O5 and a molecular weight of 452.55 g/mol. Its IUPAC name is 5-methoxy-2-[(S)-(4-methylpiperazin-1-yl)-(3,4,5-trimethoxyphenyl)methyl]naphthalen-1-ol.
| Compound Name | 5-methoxy-2-[(S)-(4-methylpiperazin-1-yl)-(3,4,5-trimethoxyphenyl)methyl]naphthalen-1-ol |
|---|---|
| PubChem CID | 29105469 |
| Molecular Formula | C26H32N2O5 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 5-methoxy-2-[(S)-(4-methylpiperazin-1-yl)-(3,4,5-trimethoxyphenyl)methyl]naphthalen-1-ol |
| SMILES | COc1cc([C@@H](c2ccc3c(OC)cccc3c2O)N2CCN(C)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C26H32N2O5/c1-27-11-13-28(14-12-27)24(17-15-22(31-3)26(33-5)23(16-17)32-4)20-10-9-18-19(25(20)29)7-6-8-21(18)30-2/h6-10,15-16,24,29H,11-14H2,1-5H3/t24-/m0/s1 |
| InChIKey | GCOVQPILSGBZPY-DEOSSOPVSA-N |
| XLogP | 3.92 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|