C27H39NO4 — CID 1112677
2,6-ditert-butyl-4-[(R)-(2,3-dimethoxyphenyl)-morpholin-4-ylmethyl]phenol (PubChem CID 1112677) has the molecular formula C27H39NO4 and a molecular weight of 441.61 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(R)-(2,3-dimethoxyphenyl)-morpholin-4-ylmethyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[(R)-(2,3-dimethoxyphenyl)-morpholin-4-ylmethyl]phenol |
|---|---|
| PubChem CID | 1112677 |
| Molecular Formula | C27H39NO4 |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.29 |
| IUPAC Name | 2,6-ditert-butyl-4-[(R)-(2,3-dimethoxyphenyl)-morpholin-4-ylmethyl]phenol |
| SMILES | COc1cccc([C@@H](c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)N2CCOCC2)c1OC |
| InChI | InChI=1S/C27H39NO4/c1-26(2,3)20-16-18(17-21(24(20)29)27(4,5)6)23(28-12-14-32-15-13-28)19-10-9-11-22(30-7)25(19)31-8/h9-11,16-17,23,29H,12-15H2,1-8H3/t23-/m1/s1 |
| InChIKey | LYGZCJMJAKLHKI-HSZRJFAPSA-N |
| XLogP | 5.43 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |