C17H17N3O3 — CID 139233851
4,10-dimethyl-9-morpholin-4-ylpyrano[2,3-f]cinnolin-2-one (PubChem CID 139233851) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is 4,10-dimethyl-9-morpholin-4-ylpyrano[2,3-f]cinnolin-2-one.
| Compound Name | 4,10-dimethyl-9-morpholin-4-ylpyrano[2,3-f]cinnolin-2-one |
|---|---|
| PubChem CID | 139233851 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 4,10-dimethyl-9-morpholin-4-ylpyrano[2,3-f]cinnolin-2-one |
| SMILES | Cc1cc(=O)oc2c1ccc1nnc(N3CCOCC3)c(C)c12 |
| InChI | InChI=1S/C17H17N3O3/c1-10-9-14(21)23-16-12(10)3-4-13-15(16)11(2)17(19-18-13)20-5-7-22-8-6-20/h3-4,9H,5-8H2,1-2H3 |
| InChIKey | UELQSAXOGUNAIL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|