C19H21NO4 — CID 5135683
6-[(3-methoxyphenyl)-pyrrolidin-1-ylmethyl]-1,3-benzodioxol-5-ol (PubChem CID 5135683) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is 6-[(3-methoxyphenyl)-pyrrolidin-1-ylmethyl]-1,3-benzodioxol-5-ol.
| Compound Name | 6-[(3-methoxyphenyl)-pyrrolidin-1-ylmethyl]-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 5135683 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 6-[(3-methoxyphenyl)-pyrrolidin-1-ylmethyl]-1,3-benzodioxol-5-ol |
| SMILES | COc1cccc(C(c2cc3c(cc2O)OCO3)N2CCCC2)c1 |
| InChI | InChI=1S/C19H21NO4/c1-22-14-6-4-5-13(9-14)19(20-7-2-3-8-20)15-10-17-18(11-16(15)21)24-12-23-17/h4-6,9-11,19,21H,2-3,7-8,12H2,1H3 |
| InChIKey | MALIRUNNORZXCE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|