C18H17Cl2N5O — CID 3573370
4-[(2-chlorophenyl)-[1-(3-chlorophenyl)tetrazol-5-yl]methyl]morpholine (PubChem CID 3573370) has the molecular formula C18H17Cl2N5O and a molecular weight of 390.27 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)-[1-(3-chlorophenyl)tetrazol-5-yl]methyl]morpholine.
| Compound Name | 4-[(2-chlorophenyl)-[1-(3-chlorophenyl)tetrazol-5-yl]methyl]morpholine |
|---|---|
| PubChem CID | 3573370 |
| Molecular Formula | C18H17Cl2N5O |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 4-[(2-chlorophenyl)-[1-(3-chlorophenyl)tetrazol-5-yl]methyl]morpholine |
| SMILES | Clc1cccc(-n2nnnc2C(c2ccccc2Cl)N2CCOCC2)c1 |
| InChI | InChI=1S/C18H17Cl2N5O/c19-13-4-3-5-14(12-13)25-18(21-22-23-25)17(24-8-10-26-11-9-24)15-6-1-2-7-16(15)20/h1-7,12,17H,8-11H2 |
| InChIKey | UNCCZQCWRLTLND-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |