C19H20ClN5 — CID 122174375
1-[[1-(3-chlorophenyl)tetrazol-5-yl]-phenylmethyl]piperidine (PubChem CID 122174375) has the molecular formula C19H20ClN5 and a molecular weight of 353.86 g/mol. Its IUPAC name is 1-[[1-(3-chlorophenyl)tetrazol-5-yl]-phenylmethyl]piperidine.
| Compound Name | 1-[[1-(3-chlorophenyl)tetrazol-5-yl]-phenylmethyl]piperidine |
|---|---|
| PubChem CID | 122174375 |
| Molecular Formula | C19H20ClN5 |
| Molecular Weight | 353.86 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 1-[[1-(3-chlorophenyl)tetrazol-5-yl]-phenylmethyl]piperidine |
| SMILES | Clc1cccc(-n2nnnc2C(c2ccccc2)N2CCCCC2)c1 |
| InChI | InChI=1S/C19H20ClN5/c20-16-10-7-11-17(14-16)25-19(21-22-23-25)18(15-8-3-1-4-9-15)24-12-5-2-6-13-24/h1,3-4,7-11,14,18H,2,5-6,12-13H2 |
| InChIKey | VTTXEZWHCFQNDV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.86 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |