C19H19Cl2N5 — CID 122174373
1-[(2-chlorophenyl)-[1-(3-chlorophenyl)tetrazol-5-yl]methyl]piperidine (PubChem CID 122174373) has the molecular formula C19H19Cl2N5 and a molecular weight of 388.30 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)-[1-(3-chlorophenyl)tetrazol-5-yl]methyl]piperidine.
| Compound Name | 1-[(2-chlorophenyl)-[1-(3-chlorophenyl)tetrazol-5-yl]methyl]piperidine |
|---|---|
| PubChem CID | 122174373 |
| Molecular Formula | C19H19Cl2N5 |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 1-[(2-chlorophenyl)-[1-(3-chlorophenyl)tetrazol-5-yl]methyl]piperidine |
| SMILES | Clc1cccc(-n2nnnc2C(c2ccccc2Cl)N2CCCCC2)c1 |
| InChI | InChI=1S/C19H19Cl2N5/c20-14-7-6-8-15(13-14)26-19(22-23-24-26)18(25-11-4-1-5-12-25)16-9-2-3-10-17(16)21/h2-3,6-10,13,18H,1,4-5,11-12H2 |
| InChIKey | YTHRKXZAJKUANG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |