C19H20NO6+ — CID 6992756
6-[(R)-1,3-benzodioxol-5-yl(morpholin-4-ium-4-yl)methyl]-1,3-benzodioxol-5-ol (PubChem CID 6992756) has the molecular formula C19H20NO6+ and a molecular weight of 358.37 g/mol. Its IUPAC name is 6-[(R)-1,3-benzodioxol-5-yl(morpholin-4-ium-4-yl)methyl]-1,3-benzodioxol-5-ol.
| Compound Name | 6-[(R)-1,3-benzodioxol-5-yl(morpholin-4-ium-4-yl)methyl]-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 6992756 |
| Molecular Formula | C19H20NO6+ |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 6-[(R)-1,3-benzodioxol-5-yl(morpholin-4-ium-4-yl)methyl]-1,3-benzodioxol-5-ol |
| SMILES | Oc1cc2c(cc1C(c1ccc3c(c1)OCO3)[NH+]1CCOCC1)OCO2 |
| InChI | InChI=1S/C19H19NO6/c21-14-9-18-17(25-11-26-18)8-13(14)19(20-3-5-22-6-4-20)12-1-2-15-16(7-12)24-10-23-15/h1-2,7-9,19,21H,3-6,10-11H2/p+1 |
| InChIKey | BJEIGUUUOWFEKX-UHFFFAOYSA-O |
| XLogP | 0.85 |
| TPSA | 70.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|