C15H16Cl2N2OS — CID 135597898
2,4-dichloro-6-[[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]iminomethyl]phenol (PubChem CID 135597898) has the molecular formula C15H16Cl2N2OS and a molecular weight of 343.28 g/mol. Its IUPAC name is 2,4-dichloro-6-[[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]iminomethyl]phenol.
| Compound Name | 2,4-dichloro-6-[[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135597898 |
| Molecular Formula | C15H16Cl2N2OS |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 2,4-dichloro-6-[[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]iminomethyl]phenol |
| SMILES | CN(C)[C@@H](C/N=C/c1cc(Cl)cc(Cl)c1O)c1cccs1 |
| InChI | InChI=1S/C15H16Cl2N2OS/c1-19(2)13(14-4-3-5-21-14)9-18-8-10-6-11(16)7-12(17)15(10)20/h3-8,13,20H,9H2,1-2H3/b18-8+/t13-/m0/s1 |
| InChIKey | LKIRVADZPRJHNM-VFJJTOLMSA-N |
| XLogP | 4.48 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|