C17H19Cl2N2O2S+ — CID 135595948
2,4-dichloro-6-[[(2S)-2-morpholin-4-ium-4-yl-2-thiophen-2-ylethyl]iminomethyl]phenol (PubChem CID 135595948) has the molecular formula C17H19Cl2N2O2S+ and a molecular weight of 386.32 g/mol. Its IUPAC name is 2,4-dichloro-6-[[(2S)-2-morpholin-4-ium-4-yl-2-thiophen-2-ylethyl]iminomethyl]phenol.
| Compound Name | 2,4-dichloro-6-[[(2S)-2-morpholin-4-ium-4-yl-2-thiophen-2-ylethyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135595948 |
| Molecular Formula | C17H19Cl2N2O2S+ |
| Molecular Weight | 386.32 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 2,4-dichloro-6-[[(2S)-2-morpholin-4-ium-4-yl-2-thiophen-2-ylethyl]iminomethyl]phenol |
| SMILES | Oc1c(Cl)cc(Cl)cc1/C=N/C[C@@H](c1cccs1)[NH+]1CCOCC1 |
| InChI | InChI=1S/C17H18Cl2N2O2S/c18-13-8-12(17(22)14(19)9-13)10-20-11-15(16-2-1-7-24-16)21-3-5-23-6-4-21/h1-2,7-10,15,22H,3-6,11H2/p+1/b20-10+/t15-/m0/s1 |
| InChIKey | JIGRMVNKFZIXKN-VYXQJKENSA-O |
| XLogP | 2.84 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|