C17H18ClN3O4S — CID 7607445
4-chloro-2-[[(2R)-2-morpholin-4-ium-4-yl-2-thiophen-2-ylethyl]iminomethyl]-6-nitrophenolate (PubChem CID 7607445) has the molecular formula C17H18ClN3O4S and a molecular weight of 395.87 g/mol. Its IUPAC name is 4-chloro-2-[[(2R)-2-morpholin-4-ium-4-yl-2-thiophen-2-ylethyl]iminomethyl]-6-nitrophenolate.
| Compound Name | 4-chloro-2-[[(2R)-2-morpholin-4-ium-4-yl-2-thiophen-2-ylethyl]iminomethyl]-6-nitrophenolate |
|---|---|
| PubChem CID | 7607445 |
| Molecular Formula | C17H18ClN3O4S |
| Molecular Weight | 395.87 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 4-chloro-2-[[(2R)-2-morpholin-4-ium-4-yl-2-thiophen-2-ylethyl]iminomethyl]-6-nitrophenolate |
| SMILES | O=[N+]([O-])c1cc(Cl)cc(/C=N/C[C@H](c2cccs2)[NH+]2CCOCC2)c1[O-] |
| InChI | InChI=1S/C17H18ClN3O4S/c18-13-8-12(17(22)14(9-13)21(23)24)10-19-11-15(16-2-1-7-26-16)20-3-5-25-6-4-20/h1-2,7-10,15,22H,3-6,11H2/b19-10+/t15-/m1/s1 |
| InChIKey | XDVHSIFWAQLJNU-GDXCHIGESA-N |
| XLogP | 1.46 |
| TPSA | 92.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.87 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|