C14H11ClN3O5S- — CID 7606115
4-chloro-2-nitro-6-[(4-sulfamoylphenyl)methyliminomethyl]phenolate (PubChem CID 7606115) has the molecular formula C14H11ClN3O5S- and a molecular weight of 368.78 g/mol. Its IUPAC name is 4-chloro-2-nitro-6-[(4-sulfamoylphenyl)methyliminomethyl]phenolate.
| Compound Name | 4-chloro-2-nitro-6-[(4-sulfamoylphenyl)methyliminomethyl]phenolate |
|---|---|
| PubChem CID | 7606115 |
| Molecular Formula | C14H11ClN3O5S- |
| Molecular Weight | 368.78 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | 4-chloro-2-nitro-6-[(4-sulfamoylphenyl)methyliminomethyl]phenolate |
| SMILES | NS(=O)(=O)c1ccc(C/N=C/c2cc(Cl)cc([N+](=O)[O-])c2[O-])cc1 |
| InChI | InChI=1S/C14H12ClN3O5S/c15-11-5-10(14(19)13(6-11)18(20)21)8-17-7-9-1-3-12(4-2-9)24(16,22)23/h1-6,8,19H,7H2,(H2,16,22,23)/p-1/b17-8+ |
| InChIKey | GVHJDGIDYIUEIJ-CAOOACKPSA-M |
| XLogP | 1.59 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.78 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|