C17H17ClN3O5S- — CID 7505665
4-chloro-2-[[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]iminomethyl]-6-nitrophenolate (PubChem CID 7505665) has the molecular formula C17H17ClN3O5S- and a molecular weight of 410.86 g/mol. Its IUPAC name is 4-chloro-2-[[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]iminomethyl]-6-nitrophenolate.
| Compound Name | 4-chloro-2-[[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]iminomethyl]-6-nitrophenolate |
|---|---|
| PubChem CID | 7505665 |
| Molecular Formula | C17H17ClN3O5S- |
| Molecular Weight | 410.86 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 4-chloro-2-[[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]iminomethyl]-6-nitrophenolate |
| SMILES | Cc1cc(S(=O)(=O)N(C)C)cc(/N=C/c2cc(Cl)cc([N+](=O)[O-])c2[O-])c1C |
| InChI | InChI=1S/C17H18ClN3O5S/c1-10-5-14(27(25,26)20(3)4)8-15(11(10)2)19-9-12-6-13(18)7-16(17(12)22)21(23)24/h5-9,22H,1-4H3/p-1/b19-9+ |
| InChIKey | SWFPSDLRWHTQBF-DJKKODMXSA-M |
| XLogP | 2.94 |
| TPSA | 115.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.86 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|