C18H23Cl2N3OS+2 — CID 135758214
2,4-dichloro-6-[[(2S)-2-(4-methylpiperazine-1,4-diium-1-yl)-2-thiophen-2-ylethyl]iminomethyl]phenol (PubChem CID 135758214) has the molecular formula C18H23Cl2N3OS+2 and a molecular weight of 400.38 g/mol. Its IUPAC name is 2,4-dichloro-6-[[(2S)-2-(4-methylpiperazine-1,4-diium-1-yl)-2-thiophen-2-ylethyl]iminomethyl]phenol.
| Compound Name | 2,4-dichloro-6-[[(2S)-2-(4-methylpiperazine-1,4-diium-1-yl)-2-thiophen-2-ylethyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135758214 |
| Molecular Formula | C18H23Cl2N3OS+2 |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 2,4-dichloro-6-[[(2S)-2-(4-methylpiperazine-1,4-diium-1-yl)-2-thiophen-2-ylethyl]iminomethyl]phenol |
| SMILES | C[NH+]1CC[NH+]([C@@H](C/N=C/c2cc(Cl)cc(Cl)c2O)c2cccs2)CC1 |
| InChI | InChI=1S/C18H21Cl2N3OS/c1-22-4-6-23(7-5-22)16(17-3-2-8-25-17)12-21-11-13-9-14(19)10-15(20)18(13)24/h2-3,8-11,16,24H,4-7,12H2,1H3/p+2/b21-11+/t16-/m0/s1 |
| InChIKey | IPQBHZPZKBFALO-XYHOIZSOSA-P |
| XLogP | 1.33 |
| TPSA | 41.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|