C16H14ClNO3 — CID 4059922
4-chloro-2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyliminomethyl)phenol (PubChem CID 4059922) has the molecular formula C16H14ClNO3 and a molecular weight of 303.75 g/mol. Its IUPAC name is 4-chloro-2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyliminomethyl)phenol.
| Compound Name | 4-chloro-2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyliminomethyl)phenol |
|---|---|
| PubChem CID | 4059922 |
| Molecular Formula | C16H14ClNO3 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 4-chloro-2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyliminomethyl)phenol |
| SMILES | Oc1ccc(Cl)cc1/C=N/CC1COc2ccccc2O1 |
| InChI | InChI=1S/C16H14ClNO3/c17-12-5-6-14(19)11(7-12)8-18-9-13-10-20-15-3-1-2-4-16(15)21-13/h1-8,13,19H,9-10H2/b18-8+ |
| InChIKey | XXIWLTIKDPJURF-QGMBQPNBSA-N |
| XLogP | 3.30 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|