C19H21NO5 — CID 3740793
N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1-(2,4,5-trimethoxyphenyl)methanimine (PubChem CID 3740793) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1-(2,4,5-trimethoxyphenyl)methanimine.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1-(2,4,5-trimethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 3740793 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1-(2,4,5-trimethoxyphenyl)methanimine |
| SMILES | COc1cc(OC)c(OC)cc1/C=N/CC1COc2ccccc2O1 |
| InChI | InChI=1S/C19H21NO5/c1-21-17-9-19(23-3)18(22-2)8-13(17)10-20-11-14-12-24-15-6-4-5-7-16(15)25-14/h4-10,14H,11-12H2,1-3H3/b20-10+ |
| InChIKey | PYMSSXKLRDHDOS-KEBDBYFISA-N |
| XLogP | 2.97 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|