C18H22IN3O4 — CID 119117183
2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1-(2,5-dimethoxyphenyl)guanidine;hydroiodide (PubChem CID 119117183) has the molecular formula C18H22IN3O4 and a molecular weight of 471.30 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1-(2,5-dimethoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1-(2,5-dimethoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119117183 |
| Molecular Formula | C18H22IN3O4 |
| Molecular Weight | 471.30 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1-(2,5-dimethoxyphenyl)guanidine;hydroiodide |
| SMILES | COc1ccc(OC)c(N/C(N)=N/CC2COc3ccccc3O2)c1.I |
| InChI | InChI=1S/C18H21N3O4.HI/c1-22-12-7-8-15(23-2)14(9-12)21-18(19)20-10-13-11-24-16-5-3-4-6-17(16)25-13;/h3-9,13H,10-11H2,1-2H3,(H3,19,20,21);1H |
| InChIKey | VRJPQKDJFYTZBR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|