C17H20IN3O3 — CID 111026750
2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1-(3-methoxyphenyl)guanidine;hydroiodide (PubChem CID 111026750) has the molecular formula C17H20IN3O3 and a molecular weight of 441.27 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1-(3-methoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1-(3-methoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111026750 |
| Molecular Formula | C17H20IN3O3 |
| Molecular Weight | 441.27 g/mol |
| Exact Mass | 441.05 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1-(3-methoxyphenyl)guanidine;hydroiodide |
| SMILES | COc1cccc(N/C(N)=N/CC2COc3ccccc3O2)c1.I |
| InChI | InChI=1S/C17H19N3O3.HI/c1-21-13-6-4-5-12(9-13)20-17(18)19-10-14-11-22-15-7-2-3-8-16(15)23-14;/h2-9,14H,10-11H2,1H3,(H3,18,19,20);1H |
| InChIKey | MWWHWCCBRQXEKO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|