C15H22F2IN3O — CID 120762442
2-[(3,3-difluorocyclohexyl)methyl]-1-(3-methoxyphenyl)guanidine;hydroiodide (PubChem CID 120762442) has the molecular formula C15H22F2IN3O and a molecular weight of 425.26 g/mol. Its IUPAC name is 2-[(3,3-difluorocyclohexyl)methyl]-1-(3-methoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-[(3,3-difluorocyclohexyl)methyl]-1-(3-methoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 120762442 |
| Molecular Formula | C15H22F2IN3O |
| Molecular Weight | 425.26 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 2-[(3,3-difluorocyclohexyl)methyl]-1-(3-methoxyphenyl)guanidine;hydroiodide |
| SMILES | COc1cccc(N/C(N)=N/CC2CCCC(F)(F)C2)c1.I |
| InChI | InChI=1S/C15H21F2N3O.HI/c1-21-13-6-2-5-12(8-13)20-14(18)19-10-11-4-3-7-15(16,17)9-11;/h2,5-6,8,11H,3-4,7,9-10H2,1H3,(H3,18,19,20);1H |
| InChIKey | DHEJITIUPBUKLN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.26 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|