C19H24IN3O2S — CID 119146572
2-(3,4-dihydro-1H-isothiochromen-1-ylmethyl)-1-(2,5-dimethoxyphenyl)guanidine;hydroiodide (PubChem CID 119146572) has the molecular formula C19H24IN3O2S and a molecular weight of 485.39 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isothiochromen-1-ylmethyl)-1-(2,5-dimethoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-(3,4-dihydro-1H-isothiochromen-1-ylmethyl)-1-(2,5-dimethoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119146572 |
| Molecular Formula | C19H24IN3O2S |
| Molecular Weight | 485.39 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | 2-(3,4-dihydro-1H-isothiochromen-1-ylmethyl)-1-(2,5-dimethoxyphenyl)guanidine;hydroiodide |
| SMILES | COc1ccc(OC)c(N/C(N)=N/CC2SCCc3ccccc32)c1.I |
| InChI | InChI=1S/C19H23N3O2S.HI/c1-23-14-7-8-17(24-2)16(11-14)22-19(20)21-12-18-15-6-4-3-5-13(15)9-10-25-18;/h3-8,11,18H,9-10,12H2,1-2H3,(H3,20,21,22);1H |
| InChIKey | QUHUMUINTXVKSK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|