C16H14ClNO2 — CID 744964
1-(4-chlorophenyl)-N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]methanimine (PubChem CID 744964) has the molecular formula C16H14ClNO2 and a molecular weight of 287.75 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]methanimine.
| Compound Name | 1-(4-chlorophenyl)-N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]methanimine |
|---|---|
| PubChem CID | 744964 |
| Molecular Formula | C16H14ClNO2 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]methanimine |
| SMILES | Clc1ccc(/C=N/C[C@@H]2COc3ccccc3O2)cc1 |
| InChI | InChI=1S/C16H14ClNO2/c17-13-7-5-12(6-8-13)9-18-10-14-11-19-15-3-1-2-4-16(15)20-14/h1-9,14H,10-11H2/b18-9+/t14-/m1/s1 |
| InChIKey | NBSGSSLVUGITLE-UHPUNMKFSA-N |
| XLogP | 3.60 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|