C21H29N3O3 — CID 136740404
(2S)-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 136740404) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is (2S)-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | (2S)-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 136740404 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | (2S)-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | CC(C)(C)c1cc(/C=N/[C@@H](Cc2cnc[nH]2)C(=O)O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H29N3O3/c1-20(2,3)14-7-13(18(25)16(8-14)21(4,5)6)10-23-17(19(26)27)9-15-11-22-12-24-15/h7-8,10-12,17,25H,9H2,1-6H3,(H,22,24)(H,26,27)/b23-10+/t17-/m0/s1 |
| InChIKey | IKIUADSQOPNPPB-LVGSUZFTSA-N |
| XLogP | 3.83 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|