C13H11N5O7 — CID 136740405
(2S)-2-[(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 136740405) has the molecular formula C13H11N5O7 and a molecular weight of 349.26 g/mol. Its IUPAC name is (2S)-2-[(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | (2S)-2-[(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 136740405 |
| Molecular Formula | C13H11N5O7 |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | (2S)-2-[(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | O=C(O)[C@H](Cc1cnc[nH]1)/N=C/c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C13H11N5O7/c19-12-7(1-9(17(22)23)3-11(12)18(24)25)4-15-10(13(20)21)2-8-5-14-6-16-8/h1,3-6,10,19H,2H2,(H,14,16)(H,20,21)/b15-4+/t10-/m0/s1 |
| InChIKey | VSDCTSDXPKNMSL-ZBMCLQOQSA-N |
| XLogP | 1.05 |
| TPSA | 184.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|