C14H9N5O5 — CID 3534071
2-(1H-indazol-5-yliminomethyl)-4,6-dinitrophenol (PubChem CID 3534071) has the molecular formula C14H9N5O5 and a molecular weight of 327.26 g/mol. Its IUPAC name is 2-(1H-indazol-5-yliminomethyl)-4,6-dinitrophenol.
| Compound Name | 2-(1H-indazol-5-yliminomethyl)-4,6-dinitrophenol |
|---|---|
| PubChem CID | 3534071 |
| Molecular Formula | C14H9N5O5 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 2-(1H-indazol-5-yliminomethyl)-4,6-dinitrophenol |
| SMILES | O=[N+]([O-])c1cc(/C=N/c2ccc3[nH]ncc3c2)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H9N5O5/c20-14-9(4-11(18(21)22)5-13(14)19(23)24)6-15-10-1-2-12-8(3-10)7-16-17-12/h1-7,20H,(H,16,17)/b15-6+ |
| InChIKey | QLLDQSUGDVREJS-GIDUJCDVSA-N |
| XLogP | 2.84 |
| TPSA | 147.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|