C14H9N5O8 — CID 139073909
2H-phthalazin-1-one;2,4,6-trinitrophenol (PubChem CID 139073909) has the molecular formula C14H9N5O8 and a molecular weight of 375.25 g/mol. Its IUPAC name is 2H-phthalazin-1-one;2,4,6-trinitrophenol.
| Compound Name | 2H-phthalazin-1-one;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 139073909 |
| Molecular Formula | C14H9N5O8 |
| Molecular Weight | 375.25 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 2H-phthalazin-1-one;2,4,6-trinitrophenol |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1.O=c1[nH]ncc2ccccc12 |
| InChI | InChI=1S/C8H6N2O.C6H3N3O7/c11-8-7-4-2-1-3-6(7)5-9-10-8;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-5H,(H,10,11);1-2,10H |
| InChIKey | BHJBZKRCGJTKRH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 195.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|