C27H36I2N2O2 — CID 136672856
2,4-ditert-butyl-6-[[1-[(2-hydroxy-3,5-diiodophenyl)methyl]pyrrolidin-2-yl]methyliminomethyl]phenol (PubChem CID 136672856) has the molecular formula C27H36I2N2O2 and a molecular weight of 674.41 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[1-[(2-hydroxy-3,5-diiodophenyl)methyl]pyrrolidin-2-yl]methyliminomethyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[[1-[(2-hydroxy-3,5-diiodophenyl)methyl]pyrrolidin-2-yl]methyliminomethyl]phenol |
|---|---|
| PubChem CID | 136672856 |
| Molecular Formula | C27H36I2N2O2 |
| Molecular Weight | 674.41 g/mol |
| Exact Mass | 674.09 |
| IUPAC Name | 2,4-ditert-butyl-6-[[1-[(2-hydroxy-3,5-diiodophenyl)methyl]pyrrolidin-2-yl]methyliminomethyl]phenol |
| SMILES | CC(C)(C)c1cc(/C=N/CC2CCCN2Cc2cc(I)cc(I)c2O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C27H36I2N2O2/c1-26(2,3)19-10-17(24(32)22(12-19)27(4,5)6)14-30-15-21-8-7-9-31(21)16-18-11-20(28)13-23(29)25(18)33/h10-14,21,32-33H,7-9,15-16H2,1-6H3/b30-14+ |
| InChIKey | YPLHTNXYSIEYSC-AMVVHIIESA-N |
| XLogP | 6.99 |
| TPSA | 56.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.41 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|