C27H36Br2N2O — CID 136927889
2,4-ditert-butyl-6-[[1-[(3,5-dibromophenyl)methyl]pyrrolidin-2-yl]methyliminomethyl]phenol (PubChem CID 136927889) has the molecular formula C27H36Br2N2O and a molecular weight of 564.41 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[1-[(3,5-dibromophenyl)methyl]pyrrolidin-2-yl]methyliminomethyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[[1-[(3,5-dibromophenyl)methyl]pyrrolidin-2-yl]methyliminomethyl]phenol |
|---|---|
| PubChem CID | 136927889 |
| Molecular Formula | C27H36Br2N2O |
| Molecular Weight | 564.41 g/mol |
| Exact Mass | 562.12 |
| IUPAC Name | 2,4-ditert-butyl-6-[[1-[(3,5-dibromophenyl)methyl]pyrrolidin-2-yl]methyliminomethyl]phenol |
| SMILES | CC(C)(C)c1cc(/C=N/CC2CCCN2Cc2cc(Br)cc(Br)c2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C27H36Br2N2O/c1-26(2,3)20-12-19(25(32)24(13-20)27(4,5)6)15-30-16-23-8-7-9-31(23)17-18-10-21(28)14-22(29)11-18/h10-15,23,32H,7-9,16-17H2,1-6H3/b30-15+ |
| InChIKey | OPTSMYHBRIHPIQ-FJEPWZHXSA-N |
| XLogP | 7.60 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.41 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|