C38H56N2O2 — CID 136745931
2,4-ditert-butyl-6-[[(1S,2R,4S,5R)-5-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-2-bicyclo[2.2.2]octanyl]iminomethyl]phenol (PubChem CID 136745931) has the molecular formula C38H56N2O2 and a molecular weight of 572.88 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[(1S,2R,4S,5R)-5-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-2-bicyclo[2.2.2]octanyl]iminomethyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[[(1S,2R,4S,5R)-5-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-2-bicyclo[2.2.2]octanyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 136745931 |
| Molecular Formula | C38H56N2O2 |
| Molecular Weight | 572.88 g/mol |
| Exact Mass | 572.43 |
| IUPAC Name | 2,4-ditert-butyl-6-[[(1S,2R,4S,5R)-5-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-2-bicyclo[2.2.2]octanyl]iminomethyl]phenol |
| SMILES | CC(C)(C)c1cc(/C=N/[C@@H]2C[C@@H]3CC[C@H]2C[C@H]3/N=C/c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C38H56N2O2/c1-35(2,3)27-15-25(33(41)29(19-27)37(7,8)9)21-39-31-17-24-14-13-23(31)18-32(24)40-22-26-16-28(36(4,5)6)20-30(34(26)42)38(10,11)12/h15-16,19-24,31-32,41-42H,13-14,17-18H2,1-12H3/b39-21+,40-22+/t23-,24-,31+,32+/m0/s1 |
| InChIKey | HKTIHRROLAODBC-YHXHTSMQSA-N |
| XLogP | 9.38 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.88 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|