About copper;4-bromo-2-[2-(2-hydroxyethylamino)ethyliminomethyl]phenolate;acetate
copper;4-bromo-2-[2-(2-hydroxyethylamino)ethyliminomethyl]phenolate;acetate (PubChem CID 56849889) has the molecular formula C13H17BrCuN2O4
and a molecular weight of 408.74 g/mol. Its IUPAC name is copper;4-bromo-2-[2-(2-hydroxyethylamino)ethyliminomethyl]phenolate;acetate.
Molecular Properties
| Compound Name | copper;4-bromo-2-[2-(2-hydroxyethylamino)ethyliminomethyl]phenolate;acetate |
| PubChem CID | 56849889 |
| Molecular Formula | C13H17BrCuN2O4 |
| Molecular Weight | 408.74 g/mol |
| Exact Mass | 406.97 |
| IUPAC Name | copper;4-bromo-2-[2-(2-hydroxyethylamino)ethyliminomethyl]phenolate;acetate |
| SMILES | CC(=O)[O-].[Cu+2].[O-]c1ccc(Br)cc1/C=N/CCNCCO |
| InChI | InChI=1S/C11H15BrN2O2.C2H4O2.Cu/c12-10-1-2-11(16)9(7-10)8-14-4-3-13-5-6-15;1-2(3)4;/h1-2,7-8,13,15-16H,3-6H2;1H3,(H,3,4);/q;;+2/p-2/b14-8+;; |
| InChIKey | XIRFICJWTFCAGL-JPMXUBAOSA-L |
| XLogP | -0.72 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.74 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze copper;4-bromo-2-[2-(2-hydroxyethylamino)ethyliminomethyl]phenolate;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;4-bromo-2-[2-(2-hydroxyethylamino)ethyliminomethyl]phenolate;acetate?
The IUPAC name of copper;4-bromo-2-[2-(2-hydroxyethylamino)ethyliminomethyl]phenolate;acetate (CID 56849889) is copper;4-bromo-2-[2-(2-hydroxyethylamino)ethyliminomethyl]phenolate;acetate.
What is the SMILES notation for copper;4-bromo-2-[2-(2-hydroxyethylamino)ethyliminomethyl]phenolate;acetate?
The canonical SMILES for copper;4-bromo-2-[2-(2-hydroxyethylamino)ethyliminomethyl]phenolate;acetate is CC(=O)[O-].[Cu+2].[O-]c1ccc(Br)cc1/C=N/CCNCCO.
What is the InChIKey of copper;4-bromo-2-[2-(2-hydroxyethylamino)ethyliminomethyl]phenolate;acetate?
The InChIKey is XIRFICJWTFCAGL-JPMXUBAOSA-L. The full InChI is InChI=1S/C11H15BrN2O2.C2H4O2.Cu/c12-10-1-2-11(16)9(7-10)8-14-4-3-13-5-6-15;1-2(3)4;/h1-2,7-8,13,15-16H,3-6H2;1H3,(H,3,4);/q;;+2/p-2/b14-8+;;.
What are the key properties of copper;4-bromo-2-[2-(2-hydroxyethylamino)ethyliminomethyl]phenolate;acetate?
copper;4-bromo-2-[2-(2-hydroxyethylamino)ethyliminomethyl]phenolate;acetate has a molecular weight of 408.74 g/mol, XLogP of -0.72, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for copper;4-bromo-2-[2-(2-hydroxyethylamino)ethyliminomethyl]phenolate;acetate is sourced from PubChem (CID 56849889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).