C12H12NNaO5 — CID 101382342
sodium 4-acetyloxy-2-(2-carboxyethyliminomethyl)phenolate (PubChem CID 101382342) has the molecular formula C12H12NNaO5 and a molecular weight of 273.22 g/mol. Its IUPAC name is sodium 4-acetyloxy-2-(2-carboxyethyliminomethyl)phenolate.
| Compound Name | sodium 4-acetyloxy-2-(2-carboxyethyliminomethyl)phenolate |
|---|---|
| PubChem CID | 101382342 |
| Molecular Formula | C12H12NNaO5 |
| Molecular Weight | 273.22 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | sodium 4-acetyloxy-2-(2-carboxyethyliminomethyl)phenolate |
| SMILES | CC(=O)Oc1ccc([O-])c(/C=N/CCC(=O)O)c1.[Na+] |
| InChI | InChI=1S/C12H13NO5.Na/c1-8(14)18-10-2-3-11(15)9(6-10)7-13-5-4-12(16)17;/h2-3,6-7,15H,4-5H2,1H3,(H,16,17);/q;+1/p-1/b13-7+; |
| InChIKey | MYPLZBRPUJIVQR-FTPOTTDRSA-M |
| XLogP | -2.42 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.22 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|