C11H12NNaO6S — CID 101382340
sodium 4-acetyloxy-2-(2-sulfoethyliminomethyl)phenolate (PubChem CID 101382340) has the molecular formula C11H12NNaO6S and a molecular weight of 309.28 g/mol. Its IUPAC name is sodium 4-acetyloxy-2-(2-sulfoethyliminomethyl)phenolate.
| Compound Name | sodium 4-acetyloxy-2-(2-sulfoethyliminomethyl)phenolate |
|---|---|
| PubChem CID | 101382340 |
| Molecular Formula | C11H12NNaO6S |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | sodium 4-acetyloxy-2-(2-sulfoethyliminomethyl)phenolate |
| SMILES | CC(=O)Oc1ccc([O-])c(/C=N/CCS(=O)(=O)O)c1.[Na+] |
| InChI | InChI=1S/C11H13NO6S.Na/c1-8(13)18-10-2-3-11(14)9(6-10)7-12-4-5-19(15,16)17;/h2-3,6-7,14H,4-5H2,1H3,(H,15,16,17);/q;+1/p-1/b12-7+; |
| InChIKey | YXSMDEQDRLOKOU-RRAJOLSVSA-M |
| XLogP | -3.00 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|