C18H18N2O4-2 — CID 102108359
5-methoxy-2-[2-[(4-methoxy-2-oxidophenyl)methylideneamino]ethyliminomethyl]phenolate (PubChem CID 102108359) has the molecular formula C18H18N2O4-2 and a molecular weight of 326.35 g/mol. Its IUPAC name is 5-methoxy-2-[2-[(4-methoxy-2-oxidophenyl)methylideneamino]ethyliminomethyl]phenolate.
| Compound Name | 5-methoxy-2-[2-[(4-methoxy-2-oxidophenyl)methylideneamino]ethyliminomethyl]phenolate |
|---|---|
| PubChem CID | 102108359 |
| Molecular Formula | C18H18N2O4-2 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 5-methoxy-2-[2-[(4-methoxy-2-oxidophenyl)methylideneamino]ethyliminomethyl]phenolate |
| SMILES | COc1ccc(/C=N/CC/N=C/c2ccc(OC)cc2[O-])c([O-])c1 |
| InChI | InChI=1S/C18H20N2O4/c1-23-15-5-3-13(17(21)9-15)11-19-7-8-20-12-14-4-6-16(24-2)10-18(14)22/h3-6,9-12,21-22H,7-8H2,1-2H3/p-2/b19-11+,20-12+ |
| InChIKey | PJRDYBFKNGIDSN-AYKLPDECSA-L |
| XLogP | 1.39 |
| TPSA | 89.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|