C22H18ClFeN2O4 — CID 50908685
iron(3+);5-methoxy-2-[[2-[(4-methoxy-2-oxidophenyl)methylideneamino]phenyl]iminomethyl]phenolate;chloride (PubChem CID 50908685) has the molecular formula C22H18ClFeN2O4 and a molecular weight of 465.69 g/mol. Its IUPAC name is iron(3+);5-methoxy-2-[[2-[(4-methoxy-2-oxidophenyl)methylideneamino]phenyl]iminomethyl]phenolate;chloride.
| Compound Name | iron(3+);5-methoxy-2-[[2-[(4-methoxy-2-oxidophenyl)methylideneamino]phenyl]iminomethyl]phenolate;chloride |
|---|---|
| PubChem CID | 50908685 |
| Molecular Formula | C22H18ClFeN2O4 |
| Molecular Weight | 465.69 g/mol |
| Exact Mass | 465.03 |
| IUPAC Name | iron(3+);5-methoxy-2-[[2-[(4-methoxy-2-oxidophenyl)methylideneamino]phenyl]iminomethyl]phenolate;chloride |
| SMILES | COc1ccc(/C=N\c2ccccc2/N=C/c2ccc(OC)cc2[O-])c([O-])c1.[Cl-].[Fe+3] |
| InChI | InChI=1S/C22H20N2O4.ClH.Fe/c1-27-17-9-7-15(21(25)11-17)13-23-19-5-3-4-6-20(19)24-14-16-8-10-18(28-2)12-22(16)26;;/h3-14,25-26H,1-2H3;1H;/q;;+3/p-3/b23-13-,24-14+;; |
| InChIKey | OSXWEPCKEQMEBV-ZXGXIZAXSA-K |
| XLogP | 0.35 |
| TPSA | 89.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.69 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|