C22H18N2O4-2 — CID 101450590
2-[[4,5-dimethoxy-2-[(2-oxidophenyl)methylideneamino]phenyl]iminomethyl]phenolate (PubChem CID 101450590) has the molecular formula C22H18N2O4-2 and a molecular weight of 374.40 g/mol. Its IUPAC name is 2-[[4,5-dimethoxy-2-[(2-oxidophenyl)methylideneamino]phenyl]iminomethyl]phenolate.
| Compound Name | 2-[[4,5-dimethoxy-2-[(2-oxidophenyl)methylideneamino]phenyl]iminomethyl]phenolate |
|---|---|
| PubChem CID | 101450590 |
| Molecular Formula | C22H18N2O4-2 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 2-[[4,5-dimethoxy-2-[(2-oxidophenyl)methylideneamino]phenyl]iminomethyl]phenolate |
| SMILES | COc1cc(/N=C/c2ccccc2[O-])c(/N=C/c2ccccc2[O-])cc1OC |
| InChI | InChI=1S/C22H20N2O4/c1-27-21-11-17(23-13-15-7-3-5-9-19(15)25)18(12-22(21)28-2)24-14-16-8-4-6-10-20(16)26/h3-14,25-26H,1-2H3/p-2/b23-13+,24-14+ |
| InChIKey | MEEPQTVSIQYOEJ-RNIAWFEPSA-L |
| XLogP | 3.35 |
| TPSA | 89.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|