C14H15N3O — CID 4646455
N-(4,6-dimethylpyrimidin-2-yl)-1-(2-methoxyphenyl)methanimine (PubChem CID 4646455) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is N-(4,6-dimethylpyrimidin-2-yl)-1-(2-methoxyphenyl)methanimine.
| Compound Name | N-(4,6-dimethylpyrimidin-2-yl)-1-(2-methoxyphenyl)methanimine |
|---|---|
| PubChem CID | 4646455 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | N-(4,6-dimethylpyrimidin-2-yl)-1-(2-methoxyphenyl)methanimine |
| SMILES | COc1ccccc1C=Nc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C14H15N3O/c1-10-8-11(2)17-14(16-10)15-9-12-6-4-5-7-13(12)18-3/h4-9H,1-3H3 |
| InChIKey | NTEQYXQFEDYSFO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 47.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|