About 1-(2-methoxyphenyl)-N-phenylmethanimine;trichloroiron
1-(2-methoxyphenyl)-N-phenylmethanimine;trichloroiron (PubChem CID 21342767) has the molecular formula C14H13Cl3FeNO
and a molecular weight of 373.47 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-N-phenylmethanimine;trichloroiron.
Molecular Properties
| Compound Name | 1-(2-methoxyphenyl)-N-phenylmethanimine;trichloroiron |
| PubChem CID | 21342767 |
| Molecular Formula | C14H13Cl3FeNO |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 371.94 |
| IUPAC Name | 1-(2-methoxyphenyl)-N-phenylmethanimine;trichloroiron |
| SMILES | COc1ccccc1/C=N/c1ccccc1.Cl[Fe](Cl)Cl |
| InChI | InChI=1S/C14H13NO.3ClH.Fe/c1-16-14-10-6-5-7-12(14)11-15-13-8-3-2-4-9-13;;;;/h2-11H,1H3;3*1H;/q;;;;+3/p-3/b15-11+;;;; |
| InChIKey | WZAKPOLSRQHPDT-KJSXAQCBSA-K |
| XLogP | 5.51 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-methoxyphenyl)-N-phenylmethanimine;trichloroiron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methoxyphenyl)-N-phenylmethanimine;trichloroiron?
The IUPAC name of 1-(2-methoxyphenyl)-N-phenylmethanimine;trichloroiron (CID 21342767) is 1-(2-methoxyphenyl)-N-phenylmethanimine;trichloroiron.
What is the SMILES notation for 1-(2-methoxyphenyl)-N-phenylmethanimine;trichloroiron?
The canonical SMILES for 1-(2-methoxyphenyl)-N-phenylmethanimine;trichloroiron is COc1ccccc1/C=N/c1ccccc1.Cl[Fe](Cl)Cl.
What is the InChIKey of 1-(2-methoxyphenyl)-N-phenylmethanimine;trichloroiron?
The InChIKey is WZAKPOLSRQHPDT-KJSXAQCBSA-K. The full InChI is InChI=1S/C14H13NO.3ClH.Fe/c1-16-14-10-6-5-7-12(14)11-15-13-8-3-2-4-9-13;;;;/h2-11H,1H3;3*1H;/q;;;;+3/p-3/b15-11+;;;;.
What are the key properties of 1-(2-methoxyphenyl)-N-phenylmethanimine;trichloroiron?
1-(2-methoxyphenyl)-N-phenylmethanimine;trichloroiron has a molecular weight of 373.47 g/mol, XLogP of 5.51, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methoxyphenyl)-N-phenylmethanimine;trichloroiron is sourced from PubChem (CID 21342767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).