C21H18N2O2 — CID 136671201
4-methoxy-2,5-bis(phenyliminomethyl)phenol (PubChem CID 136671201) has the molecular formula C21H18N2O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is 4-methoxy-2,5-bis(phenyliminomethyl)phenol.
| Compound Name | 4-methoxy-2,5-bis(phenyliminomethyl)phenol |
|---|---|
| PubChem CID | 136671201 |
| Molecular Formula | C21H18N2O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 4-methoxy-2,5-bis(phenyliminomethyl)phenol |
| SMILES | COc1cc(/C=N/c2ccccc2)c(O)cc1/C=N/c1ccccc1 |
| InChI | InChI=1S/C21H18N2O2/c1-25-21-13-16(14-22-18-8-4-2-5-9-18)20(24)12-17(21)15-23-19-10-6-3-7-11-19/h2-15,24H,1H3/b22-14+,23-15+ |
| InChIKey | VNFJBIGLHMVNOK-HOFJZWJUSA-N |
| XLogP | 4.90 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|